C14H21Cl3N4O2 — CID 119848066
[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride (PubChem CID 119848066) has the molecular formula C14H21Cl3N4O2 and a molecular weight of 383.71 g/mol. Its IUPAC name is [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride.
| Compound Name | [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 119848066 |
| Molecular Formula | C14H21Cl3N4O2 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [4-(5-chloro-2-pyridinyl)piperazin-1-yl]-morpholin-2-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(C1CNCCO1)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H19ClN4O2.2ClH/c15-11-1-2-13(17-9-11)18-4-6-19(7-5-18)14(20)12-10-16-3-8-21-12;;/h1-2,9,12,16H,3-8,10H2;2*1H |
| InChIKey | CSROIGYRQOBAJV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |