C16H19ClFN3O3 — CID 119756657
[4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-morpholin-2-ylmethanone (PubChem CID 119756657) has the molecular formula C16H19ClFN3O3 and a molecular weight of 355.80 g/mol. Its IUPAC name is [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119756657 |
| Molecular Formula | C16H19ClFN3O3 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [4-(2-chloro-6-fluorobenzoyl)piperazin-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CCN(C(=O)C2CNCCO2)CC1 |
| InChI | InChI=1S/C16H19ClFN3O3/c17-11-2-1-3-12(18)14(11)16(23)21-7-5-20(6-8-21)15(22)13-10-19-4-9-24-13/h1-3,13,19H,4-10H2 |
| InChIKey | HSPQJBDWYJAWLC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |