C14H20ClN3O4 — CID 119673067
[4-(furan-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride (PubChem CID 119673067) has the molecular formula C14H20ClN3O4 and a molecular weight of 329.78 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride.
| Compound Name | [4-(furan-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119673067 |
| Molecular Formula | C14H20ClN3O4 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | [4-(furan-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccco1)N1CCN(C(=O)C2CNCCO2)CC1 |
| InChI | InChI=1S/C14H19N3O4.ClH/c18-13(11-2-1-8-20-11)16-4-6-17(7-5-16)14(19)12-10-15-3-9-21-12;/h1-2,8,12,15H,3-7,9-10H2;1H |
| InChIKey | DVBNIWZTMRGCQY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |