C15H21N3O4S — CID 119678332
[4-(benzenesulfonyl)piperazin-1-yl]-morpholin-2-ylmethanone (PubChem CID 119678332) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119678332 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O4S/c19-15(14-12-16-6-11-22-14)17-7-9-18(10-8-17)23(20,21)13-4-2-1-3-5-13/h1-5,14,16H,6-12H2 |
| InChIKey | MOJPRUINVBNWBZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |