C16H22FN3O4S — CID 119696011
[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-morpholin-2-ylmethanone (PubChem CID 119696011) has the molecular formula C16H22FN3O4S and a molecular weight of 371.43 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119696011 |
| Molecular Formula | C16H22FN3O4S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H22FN3O4S/c17-13-2-4-14(5-3-13)25(22,23)20-8-1-7-19(9-10-20)16(21)15-12-18-6-11-24-15/h2-5,15,18H,1,6-12H2 |
| InChIKey | SVYHZDLWDAXYRU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |