C17H25N3O3S — CID 119302951
[4-(benzenesulfonyl)-1,4-diazepan-1-yl]-piperidin-3-ylmethanone (PubChem CID 119302951) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-1,4-diazepan-1-yl]-piperidin-3-ylmethanone.
| Compound Name | [4-(benzenesulfonyl)-1,4-diazepan-1-yl]-piperidin-3-ylmethanone |
|---|---|
| PubChem CID | 119302951 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [4-(benzenesulfonyl)-1,4-diazepan-1-yl]-piperidin-3-ylmethanone |
| SMILES | O=C(C1CCCNC1)N1CCCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(15-6-4-9-18-14-15)19-10-5-11-20(13-12-19)24(22,23)16-7-2-1-3-8-16/h1-3,7-8,15,18H,4-6,9-14H2 |
| InChIKey | VLXHJQYTQOIGAH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |