C12H21N3O3 — CID 67493567
4-(piperidine-3-carbonyl)-1,4-diazepane-1-carboxylic acid (PubChem CID 67493567) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-(piperidine-3-carbonyl)-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-(piperidine-3-carbonyl)-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 67493567 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-(piperidine-3-carbonyl)-1,4-diazepane-1-carboxylic acid |
| SMILES | O=C(O)N1CCCN(C(=O)C2CCCNC2)CC1 |
| InChI | InChI=1S/C12H21N3O3/c16-11(10-3-1-4-13-9-10)14-5-2-6-15(8-7-14)12(17)18/h10,13H,1-9H2,(H,17,18) |
| InChIKey | YBRNKQBSEOSSLB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |