C10H20N4O3S — CID 54916601
4-(piperidine-3-carbonyl)piperazine-1-sulfonamide (PubChem CID 54916601) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-(piperidine-3-carbonyl)piperazine-1-sulfonamide.
| Compound Name | 4-(piperidine-3-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 54916601 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(piperidine-3-carbonyl)piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)C2CCCNC2)CC1 |
| InChI | InChI=1S/C10H20N4O3S/c11-18(16,17)14-6-4-13(5-7-14)10(15)9-2-1-3-12-8-9/h9,12H,1-8H2,(H2,11,16,17) |
| InChIKey | URJMMLSUWBBTRQ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |