C15H22ClN3O3S — CID 119745412
[4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride (PubChem CID 119745412) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is [4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride.
| Compound Name | [4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 119745412 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [4-(5-methylthiophene-2-carbonyl)piperazin-1-yl]-morpholin-2-ylmethanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)C3CNCCO3)CC2)s1.Cl |
| InChI | InChI=1S/C15H21N3O3S.ClH/c1-11-2-3-13(22-11)15(20)18-7-5-17(6-8-18)14(19)12-10-16-4-9-21-12;/h2-3,12,16H,4-10H2,1H3;1H |
| InChIKey | NUBPUCSHVMBDBD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |