C11H15NOS — CID 22375343
(5-methylthiophen-2-yl)-piperidin-1-ylmethanone (PubChem CID 22375343) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is (5-methylthiophen-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (5-methylthiophen-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 22375343 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (5-methylthiophen-2-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(C(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C11H15NOS/c1-9-5-6-10(14-9)11(13)12-7-3-2-4-8-12/h5-6H,2-4,7-8H2,1H3 |
| InChIKey | MJFPFOWOSXUGPT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |