C16H20N4O2S — CID 56908154
[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-morpholin-2-ylmethanone (PubChem CID 56908154) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 56908154 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C16H20N4O2S/c21-16(13-11-17-5-10-22-13)20-8-6-19(7-9-20)15-12-3-1-2-4-14(12)23-18-15/h1-4,13,17H,5-11H2 |
| InChIKey | RBWKUOVZDAJBMG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |