C19H24N2O2 — CID 98330437
[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 98330437) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 98330437 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3C[C@H]4C=C[C@H]3C4)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O2/c1-23-17-6-4-16(5-7-17)20-8-10-21(11-9-20)19(22)18-13-14-2-3-15(18)12-14/h2-7,14-15,18H,8-13H2,1H3/t14-,15-,18-/m0/s1 |
| InChIKey | LXXNKJGAIKJHBZ-MPGHIAIKSA-N |
| XLogP | 2.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|