C20H25N2O4- — CID 18557523
(1R,2S,3S,4R)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 18557523) has the molecular formula C20H25N2O4- and a molecular weight of 357.43 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1R,2S,3S,4R)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18557523 |
| Molecular Formula | C20H25N2O4- |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (1R,2S,3S,4R)-3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3[C@@H]4CC[C@H](C4)[C@@H]3C(=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-26-16-6-4-15(5-7-16)21-8-10-22(11-9-21)19(23)17-13-2-3-14(12-13)18(17)20(24)25/h4-7,13-14,17-18H,2-3,8-12H2,1H3,(H,24,25)/p-1/t13-,14-,17+,18+/m1/s1 |
| InChIKey | ZLMRXHAVINLZGK-KNCCTNLNSA-M |
| XLogP | 0.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|