C30H33N3O5 — CID 22422436
1,5-bis(4-methoxyphenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 22422436) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1,5-bis(4-methoxyphenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 22422436 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C2C(C(=O)N3CCN(c4ccc(OC)cc4)CC3)CC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H33N3O5/c1-36-24-10-4-21(5-11-24)29-27(20-28(34)33(29)23-8-14-26(38-3)15-9-23)30(35)32-18-16-31(17-19-32)22-6-12-25(37-2)13-7-22/h4-15,27,29H,16-20H2,1-3H3 |
| InChIKey | PTGJENBUJKIRDF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|