C19H19NO5 — CID 3244527
1,2-bis(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 3244527) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1,2-bis(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 3244527 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc(C2C(C(=O)O)CC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19NO5/c1-24-14-7-3-12(4-8-14)18-16(19(22)23)11-17(21)20(18)13-5-9-15(25-2)10-6-13/h3-10,16,18H,11H2,1-2H3,(H,22,23) |
| InChIKey | XKBKJKQBOSAGPZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |