C19H19NO4S — CID 171320510
4-(4-methoxyphenyl)-3-(4-methylphenyl)-5-oxothiomorpholine-2-carboxylic acid (PubChem CID 171320510) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-(4-methylphenyl)-5-oxothiomorpholine-2-carboxylic acid.
| Compound Name | 4-(4-methoxyphenyl)-3-(4-methylphenyl)-5-oxothiomorpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 171320510 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-(4-methylphenyl)-5-oxothiomorpholine-2-carboxylic acid |
| SMILES | COc1ccc(N2C(=O)CSC(C(=O)O)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H19NO4S/c1-12-3-5-13(6-4-12)17-18(19(22)23)25-11-16(21)20(17)14-7-9-15(24-2)10-8-14/h3-10,17-18H,11H2,1-2H3,(H,22,23) |
| InChIKey | QIDFAIJBXDTUJC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |