C20H21NO4 — CID 171320483
1-(4-methoxyphenyl)-2-(4-methylphenyl)-6-oxopiperidine-3-carboxylic acid (PubChem CID 171320483) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(4-methylphenyl)-6-oxopiperidine-3-carboxylic acid.
| Compound Name | 1-(4-methoxyphenyl)-2-(4-methylphenyl)-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 171320483 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(4-methylphenyl)-6-oxopiperidine-3-carboxylic acid |
| SMILES | COc1ccc(N2C(=O)CCC(C(=O)O)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-13-3-5-14(6-4-13)19-17(20(23)24)11-12-18(22)21(19)15-7-9-16(25-2)10-8-15/h3-10,17,19H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | QSFOLKLMGHYCFK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |