C27H28N2O4 — CID 43020518
1,2-bis(4-methoxyphenyl)-N-methyl-6-oxo-N-phenylpiperidine-3-carboxamide (PubChem CID 43020518) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1,2-bis(4-methoxyphenyl)-N-methyl-6-oxo-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1,2-bis(4-methoxyphenyl)-N-methyl-6-oxo-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43020518 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1,2-bis(4-methoxyphenyl)-N-methyl-6-oxo-N-phenylpiperidine-3-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)N(C)c3ccccc3)CCC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-28(20-7-5-4-6-8-20)27(31)24-17-18-25(30)29(21-11-15-23(33-3)16-12-21)26(24)19-9-13-22(32-2)14-10-19/h4-16,24,26H,17-18H2,1-3H3 |
| InChIKey | OHPCAXGMGQTOJN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |