C25H30N2O3 — CID 9398550
(2S,3S)-N-cyclohexyl-1-(4-methoxyphenyl)-6-oxo-2-phenylpiperidine-3-carboxamide (PubChem CID 9398550) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2S,3S)-N-cyclohexyl-1-(4-methoxyphenyl)-6-oxo-2-phenylpiperidine-3-carboxamide.
| Compound Name | (2S,3S)-N-cyclohexyl-1-(4-methoxyphenyl)-6-oxo-2-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 9398550 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (2S,3S)-N-cyclohexyl-1-(4-methoxyphenyl)-6-oxo-2-phenylpiperidine-3-carboxamide |
| SMILES | COc1ccc(N2C(=O)CC[C@H](C(=O)NC3CCCCC3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-30-21-14-12-20(13-15-21)27-23(28)17-16-22(24(27)18-8-4-2-5-9-18)25(29)26-19-10-6-3-7-11-19/h2,4-5,8-9,12-15,19,22,24H,3,6-7,10-11,16-17H2,1H3,(H,26,29)/t22-,24+/m0/s1 |
| InChIKey | XQJKPKZPOBLXOE-LADGPHEKSA-N |
| XLogP | 4.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |