C26H32N2O4 — CID 15993815
N-cyclohexyl-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 15993815) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-cyclohexyl-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-cyclohexyl-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 15993815 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-cyclohexyl-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(C2C(C(=O)NC3CCCCC3)CCC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-31-21-12-8-18(9-13-21)25-23(26(30)27-19-6-4-3-5-7-19)16-17-24(29)28(25)20-10-14-22(32-2)15-11-20/h8-15,19,23,25H,3-7,16-17H2,1-2H3,(H,27,30) |
| InChIKey | BGFDADYYTNXZCS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |