C27H27N3O5 — CID 26252939
(2S,3R)-N-(4-carbamoylphenyl)-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 26252939) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2S,3R)-N-(4-carbamoylphenyl)-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | (2S,3R)-N-(4-carbamoylphenyl)-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 26252939 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (2S,3R)-N-(4-carbamoylphenyl)-1,2-bis(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(C2[C@H](C(=O)Nc3ccc(C(N)=O)cc3)CCC(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O5/c1-34-21-11-5-17(6-12-21)25-23(27(33)29-19-7-3-18(4-8-19)26(28)32)15-16-24(31)30(25)20-9-13-22(35-2)14-10-20/h3-14,23,25H,15-16H2,1-2H3,(H2,28,32)(H,29,33)/t23-,25?/m1/s1 |
| InChIKey | RJXMFLZFHXWAET-XQZUBTRRSA-N |
| XLogP | 3.93 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |