C28H28N2O5 — CID 42999456
N-(4-acetylphenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 42999456) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42999456 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-(4-acetylphenyl)-2-(2-methoxyphenyl)-1-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(N2C(=O)CCC(C(=O)Nc3ccc(C(C)=O)cc3)C2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C28H28N2O5/c1-18(31)19-8-10-20(11-9-19)29-28(33)24-16-17-26(32)30(21-12-14-22(34-2)15-13-21)27(24)23-6-4-5-7-25(23)35-3/h4-15,24,27H,16-17H2,1-3H3,(H,29,33) |
| InChIKey | VYXPLXYJTXJSAJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |