C37H43NO6 — CID 140837318
2-bicyclo[2.2.1]hept-5-enyl-[4-(hydroxymethyl)-4-[tris(4-methoxyphenyl)methoxymethyl]piperidin-1-yl]methanone (PubChem CID 140837318) has the molecular formula C37H43NO6 and a molecular weight of 597.75 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl-[4-(hydroxymethyl)-4-[tris(4-methoxyphenyl)methoxymethyl]piperidin-1-yl]methanone.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl-[4-(hydroxymethyl)-4-[tris(4-methoxyphenyl)methoxymethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 140837318 |
| Molecular Formula | C37H43NO6 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl-[4-(hydroxymethyl)-4-[tris(4-methoxyphenyl)methoxymethyl]piperidin-1-yl]methanone |
| SMILES | COc1ccc(C(OCC2(CO)CCN(C(=O)C3CC4C=CC3C4)CC2)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H43NO6/c1-41-31-12-6-28(7-13-31)37(29-8-14-32(42-2)15-9-29,30-10-16-33(43-3)17-11-30)44-25-36(24-39)18-20-38(21-19-36)35(40)34-23-26-4-5-27(34)22-26/h4-17,26-27,34,39H,18-25H2,1-3H3 |
| InChIKey | LKNVDZJMMGTRJN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|