C23H32N2O2 — CID 98329668
[4-(adamantane-1-carbonyl)piperazin-1-yl]-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methanone (PubChem CID 98329668) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [4-(adamantane-1-carbonyl)piperazin-1-yl]-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methanone.
| Compound Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methanone |
|---|---|
| PubChem CID | 98329668 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [4-(adamantane-1-carbonyl)piperazin-1-yl]-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methanone |
| SMILES | O=C([C@H]1C[C@H]2C=C[C@H]1C2)N1CCN(C(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H32N2O2/c26-21(20-11-15-1-2-19(20)10-15)24-3-5-25(6-4-24)22(27)23-12-16-7-17(13-23)9-18(8-16)14-23/h1-2,15-20H,3-14H2/t15-,16?,17?,18?,19-,20-,23?/m0/s1 |
| InChIKey | FUTJDOQBBOZVIN-REPKGXIFSA-N |
| XLogP | 3.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|