About (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone
(4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone (PubChem CID 7471137) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone.
Molecular Properties
| Compound Name | (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone |
| PubChem CID | 7471137 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone |
| SMILES | CN1CCN(C(=O)C23CC4C[C@@H](CC[C@@H](C4)C2)C3)CC1 |
| InChI | InChI=1S/C17H28N2O/c1-18-4-6-19(7-5-18)16(20)17-10-13-2-3-14(11-17)9-15(8-13)12-17/h13-15H,2-12H2,1H3/t13-,14+,15?,17? |
| InChIKey | YQKPMZXPYHVBMX-KWOWKCNFSA-N |
| XLogP | 2.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone?
The IUPAC name of (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone (CID 7471137) is (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone.
What is the SMILES notation for (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone?
The canonical SMILES for (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone is CN1CCN(C(=O)C23CC4C[C@@H](CC[C@@H](C4)C2)C3)CC1.
What is the InChIKey of (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone?
The InChIKey is YQKPMZXPYHVBMX-KWOWKCNFSA-N. The full InChI is InChI=1S/C17H28N2O/c1-18-4-6-19(7-5-18)16(20)17-10-13-2-3-14(11-17)9-15(8-13)12-17/h13-15H,2-12H2,1H3/t13-,14+,15?,17?.
What are the key properties of (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone?
(4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone has a molecular weight of 276.42 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpiperazin-1-yl)-[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methanone is sourced from PubChem (CID 7471137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).