C18H30ClN2O- — CID 53351415
(3,5-dimethyl-1-adamantyl)-(4-methylpiperazin-1-yl)methanone chloride (PubChem CID 53351415) has the molecular formula C18H30ClN2O- and a molecular weight of 325.90 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(4-methylpiperazin-1-yl)methanone chloride.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(4-methylpiperazin-1-yl)methanone chloride |
|---|---|
| PubChem CID | 53351415 |
| Molecular Formula | C18H30ClN2O- |
| Molecular Weight | 325.90 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(4-methylpiperazin-1-yl)methanone chloride |
| SMILES | CN1CCN(C(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)CC1.[Cl-] |
| InChI | InChI=1S/C18H30N2O.ClH/c1-16-8-14-9-17(2,11-16)13-18(10-14,12-16)15(21)20-6-4-19(3)5-7-20;/h14H,4-13H2,1-3H3;1H/p-1 |
| InChIKey | ZBJMGIJCWZKHBP-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.90 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |