C19H32N2O — CID 119564263
(3,5-dimethyl-1-adamantyl)-(3,5-dimethylpiperazin-1-yl)methanone (PubChem CID 119564263) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(3,5-dimethylpiperazin-1-yl)methanone.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(3,5-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119564263 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(3,5-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)CC(C)N1 |
| InChI | InChI=1S/C19H32N2O/c1-13-8-21(9-14(2)20-13)16(22)19-7-15-5-17(3,11-19)10-18(4,6-15)12-19/h13-15,20H,5-12H2,1-4H3 |
| InChIKey | JEQHDAILQDEWIR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |