C19H23ClN2O — CID 11934624
[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 11934624) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11934624 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H23ClN2O/c1-13-2-5-16(20)12-18(13)21-6-8-22(9-7-21)19(23)17-11-14-3-4-15(17)10-14/h2-5,12,14-15,17H,6-11H2,1H3/t14-,15+,17-/m1/s1 |
| InChIKey | RLOWXYHVRGCUCN-HLLBOEOZSA-N |
| XLogP | 3.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|