C17H24ClN3OS — CID 119940677
1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone (PubChem CID 119940677) has the molecular formula C17H24ClN3OS and a molecular weight of 353.92 g/mol. Its IUPAC name is 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119940677 |
| Molecular Formula | C17H24ClN3OS |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)CC2CSCCN2)CC1 |
| InChI | InChI=1S/C17H24ClN3OS/c1-13-2-3-14(18)10-16(13)20-5-7-21(8-6-20)17(22)11-15-12-23-9-4-19-15/h2-3,10,15,19H,4-9,11-12H2,1H3 |
| InChIKey | KJZRHLKQOFUSDA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |