C15H23BrCl2N4OS — CID 119941169
1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride (PubChem CID 119941169) has the molecular formula C15H23BrCl2N4OS and a molecular weight of 458.25 g/mol. Its IUPAC name is 1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride.
| Compound Name | 1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119941169 |
| Molecular Formula | C15H23BrCl2N4OS |
| Molecular Weight | 458.25 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]-2-thiomorpholin-3-ylethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)N1CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C15H21BrN4OS.2ClH/c16-12-1-2-14(18-10-12)19-4-6-20(7-5-19)15(21)9-13-11-22-8-3-17-13;;/h1-2,10,13,17H,3-9,11H2;2*1H |
| InChIKey | QATNBBXPAVQALS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |