C23H31Cl2N3OS — CID 119940612
1-(4-benzhydrylpiperazin-1-yl)-2-thiomorpholin-3-ylethanone;dihydrochloride (PubChem CID 119940612) has the molecular formula C23H31Cl2N3OS and a molecular weight of 468.49 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-thiomorpholin-3-ylethanone;dihydrochloride.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-thiomorpholin-3-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119940612 |
| Molecular Formula | C23H31Cl2N3OS |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-thiomorpholin-3-ylethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3OS.2ClH/c27-22(17-21-18-28-16-11-24-21)25-12-14-26(15-13-25)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20;;/h1-10,21,23-24H,11-18H2;2*1H |
| InChIKey | YEOHUCOBFJBMNP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |