C20H32N4OS — CID 119941992
1-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]-2-thiomorpholin-3-ylethanone (PubChem CID 119941992) has the molecular formula C20H32N4OS and a molecular weight of 376.57 g/mol. Its IUPAC name is 1-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]-2-thiomorpholin-3-ylethanone.
| Compound Name | 1-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
|---|---|
| PubChem CID | 119941992 |
| Molecular Formula | C20H32N4OS |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-[4-[2-[benzyl(methyl)amino]ethyl]piperazin-1-yl]-2-thiomorpholin-3-ylethanone |
| SMILES | CN(CCN1CCN(C(=O)CC2CSCCN2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C20H32N4OS/c1-22(16-18-5-3-2-4-6-18)8-9-23-10-12-24(13-11-23)20(25)15-19-17-26-14-7-21-19/h2-6,19,21H,7-17H2,1H3 |
| InChIKey | JLMATUDPAQRBMG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |