C17H27N5OS — CID 119942596
N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119942596) has the molecular formula C17H27N5OS and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119942596 |
| Molecular Formula | C17H27N5OS |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)CC3CSCCN3)cn2)CC1 |
| InChI | InChI=1S/C17H27N5OS/c1-21-5-7-22(8-6-21)16-3-2-14(11-19-16)12-20-17(23)10-15-13-24-9-4-18-15/h2-3,11,15,18H,4-10,12-13H2,1H3,(H,20,23) |
| InChIKey | ZGTPAYJYBPBQHJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |