C16H21ClN4OS — CID 119936845
N-[(4-pyrazol-1-ylphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936845) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is N-[(4-pyrazol-1-ylphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[(4-pyrazol-1-ylphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936845 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[(4-pyrazol-1-ylphenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C16H20N4OS.ClH/c21-16(10-14-12-22-9-7-17-14)18-11-13-2-4-15(5-3-13)20-8-1-6-19-20;/h1-6,8,14,17H,7,9-12H2,(H,18,21);1H |
| InChIKey | XUDYEXKUHYSXDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |