C14H18ClF3N2OS — CID 119935770
2-thiomorpholin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;hydrochloride (PubChem CID 119935770) has the molecular formula C14H18ClF3N2OS and a molecular weight of 354.83 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;hydrochloride.
| Compound Name | 2-thiomorpholin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119935770 |
| Molecular Formula | C14H18ClF3N2OS |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-thiomorpholin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2OS.ClH/c15-14(16,17)11-3-1-10(2-4-11)8-19-13(20)7-12-9-21-6-5-18-12;/h1-4,12,18H,5-9H2,(H,19,20);1H |
| InChIKey | VSERJZLRSDWTGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |