C13H14ClF3N2OS — CID 66422398
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66422398) has the molecular formula C13H14ClF3N2OS and a molecular weight of 338.78 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66422398 |
| Molecular Formula | C13H14ClF3N2OS |
| Molecular Weight | 338.78 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C13H14ClF3N2OS/c14-10-2-1-8(13(15,16)17)5-11(10)19-12(20)6-9-7-21-4-3-18-9/h1-2,5,9,18H,3-4,6-7H2,(H,19,20) |
| InChIKey | FNMATZGXKZJSKL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |