C16H21F3N2O3S — CID 119935157
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119935157) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935157 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C16H21F3N2O3S/c1-23-5-6-24-14-3-2-11(16(17,18)19)8-13(14)21-15(22)9-12-10-25-7-4-20-12/h2-3,8,12,20H,4-7,9-10H2,1H3,(H,21,22) |
| InChIKey | AIQNSQKVOIFIFU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|