C15H18F2N2O4S — CID 119939096
methyl 3-(difluoromethoxy)-4-[(2-thiomorpholin-3-ylacetyl)amino]benzoate (PubChem CID 119939096) has the molecular formula C15H18F2N2O4S and a molecular weight of 360.38 g/mol. Its IUPAC name is methyl 3-(difluoromethoxy)-4-[(2-thiomorpholin-3-ylacetyl)amino]benzoate.
| Compound Name | methyl 3-(difluoromethoxy)-4-[(2-thiomorpholin-3-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 119939096 |
| Molecular Formula | C15H18F2N2O4S |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 3-(difluoromethoxy)-4-[(2-thiomorpholin-3-ylacetyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2CSCCN2)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H18F2N2O4S/c1-22-14(21)9-2-3-11(12(6-9)23-15(16)17)19-13(20)7-10-8-24-5-4-18-10/h2-3,6,10,15,18H,4-5,7-8H2,1H3,(H,19,20) |
| InChIKey | VGWZTRQDTJVDDA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |