C14H19ClF2N2O2S — CID 119935910
N-[[2-(difluoromethoxy)phenyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119935910) has the molecular formula C14H19ClF2N2O2S and a molecular weight of 352.83 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119935910 |
| Molecular Formula | C14H19ClF2N2O2S |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H18F2N2O2S.ClH/c15-14(16)20-12-4-2-1-3-10(12)8-18-13(19)7-11-9-21-6-5-17-11;/h1-4,11,14,17H,5-9H2,(H,18,19);1H |
| InChIKey | JNFWCWLEARMYCX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |