C14H20ClFN2O2S — CID 119936634
N-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936634) has the molecular formula C14H20ClFN2O2S and a molecular weight of 334.84 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936634 |
| Molecular Formula | C14H20ClFN2O2S |
| Molecular Weight | 334.84 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NCC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O2S.ClH/c15-11-3-1-10(2-4-11)13(18)8-17-14(19)7-12-9-20-6-5-16-12;/h1-4,12-13,16,18H,5-9H2,(H,17,19);1H |
| InChIKey | PJWRIQWEVNOSOT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |