C15H21FN2O3S — CID 119937858
N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119937858) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119937858 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O3S/c16-11-1-3-14(4-2-11)21-9-13(19)8-18-15(20)7-12-10-22-6-5-17-12/h1-4,12-13,17,19H,5-10H2,(H,18,20) |
| InChIKey | RNBDLIJWIMFYBV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |