C17H20Cl2FN3O2S — CID 119941203
N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941203) has the molecular formula C17H20Cl2FN3O2S and a molecular weight of 420.34 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941203 |
| Molecular Formula | C17H20Cl2FN3O2S |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C17H18FN3O2S.2ClH/c18-12-1-4-15(5-2-12)23-17-6-3-13(10-20-17)21-16(22)9-14-11-24-8-7-19-14;;/h1-6,10,14,19H,7-9,11H2,(H,21,22);2*1H |
| InChIKey | PLCTYYVTCURFIV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |