C18H23Cl2N3O2S — CID 119941281
N-[6-(4-methylphenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941281) has the molecular formula C18H23Cl2N3O2S and a molecular weight of 416.37 g/mol. Its IUPAC name is N-[6-(4-methylphenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[6-(4-methylphenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941281 |
| Molecular Formula | C18H23Cl2N3O2S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[6-(4-methylphenoxy)-3-pyridinyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)CC3CSCCN3)cn2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H21N3O2S.2ClH/c1-13-2-5-16(6-3-13)23-18-7-4-14(11-20-18)21-17(22)10-15-12-24-9-8-19-15;;/h2-7,11,15,19H,8-10,12H2,1H3,(H,21,22);2*1H |
| InChIKey | AJOXWXBZVFUVLN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |