C15H20N2O4S — CID 119936369
methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]phenoxy]acetate (PubChem CID 119936369) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 119936369 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CC2CSCCN2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-20-15(19)9-21-13-4-2-11(3-5-13)17-14(18)8-12-10-22-7-6-16-12/h2-5,12,16H,6-10H2,1H3,(H,17,18) |
| InChIKey | SQSQTLPSRCHCJA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |