C19H23ClN2O4S — CID 119940181
methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]naphthalen-1-yl]oxyacetate;hydrochloride (PubChem CID 119940181) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]naphthalen-1-yl]oxyacetate;hydrochloride.
| Compound Name | methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]naphthalen-1-yl]oxyacetate;hydrochloride |
|---|---|
| PubChem CID | 119940181 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl 2-[4-[(2-thiomorpholin-3-ylacetyl)amino]naphthalen-1-yl]oxyacetate;hydrochloride |
| SMILES | COC(=O)COc1ccc(NC(=O)CC2CSCCN2)c2ccccc12.Cl |
| InChI | InChI=1S/C19H22N2O4S.ClH/c1-24-19(23)11-25-17-7-6-16(14-4-2-3-5-15(14)17)21-18(22)10-13-12-26-9-8-20-13;/h2-7,13,20H,8-12H2,1H3,(H,21,22);1H |
| InChIKey | ADPGMWGWCCGVNC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |