C18H23ClN2O5 — CID 119811923
methyl 2-[4-[[2-(2-methoxyethylamino)acetyl]amino]naphthalen-1-yl]oxyacetate;hydrochloride (PubChem CID 119811923) has the molecular formula C18H23ClN2O5 and a molecular weight of 382.84 g/mol. Its IUPAC name is methyl 2-[4-[[2-(2-methoxyethylamino)acetyl]amino]naphthalen-1-yl]oxyacetate;hydrochloride.
| Compound Name | methyl 2-[4-[[2-(2-methoxyethylamino)acetyl]amino]naphthalen-1-yl]oxyacetate;hydrochloride |
|---|---|
| PubChem CID | 119811923 |
| Molecular Formula | C18H23ClN2O5 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 2-[4-[[2-(2-methoxyethylamino)acetyl]amino]naphthalen-1-yl]oxyacetate;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(OCC(=O)OC)c2ccccc12.Cl |
| InChI | InChI=1S/C18H22N2O5.ClH/c1-23-10-9-19-11-17(21)20-15-7-8-16(25-12-18(22)24-2)14-6-4-3-5-13(14)15;/h3-8,19H,9-12H2,1-2H3,(H,20,21);1H |
| InChIKey | GIJKBRBFCBMZLQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|