C14H20N2O5 — CID 119713774
methyl 2-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenoxy]acetate (PubChem CID 119713774) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 2-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 119713774 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | methyl 2-[3-[[2-(2-methoxyethylamino)acetyl]amino]phenoxy]acetate |
| SMILES | COCCNCC(=O)Nc1cccc(OCC(=O)OC)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-19-7-6-15-9-13(17)16-11-4-3-5-12(8-11)21-10-14(18)20-2/h3-5,8,15H,6-7,9-10H2,1-2H3,(H,16,17) |
| InChIKey | BSFBEFUVRGQDEJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|