C19H24N2O4 — CID 54819962
2-(2-methoxyethylamino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 54819962) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54819962 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | COCCNCC(=O)Nc1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-23-11-10-20-15-19(22)21-16-6-5-9-18(14-16)25-13-12-24-17-7-3-2-4-8-17/h2-9,14,20H,10-13,15H2,1H3,(H,21,22) |
| InChIKey | SDZSKDOGKGJYMK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|