C13H21ClN2O4 — CID 119674285
N-(2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119674285) has the molecular formula C13H21ClN2O4 and a molecular weight of 304.77 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119674285 |
| Molecular Formula | C13H21ClN2O4 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1cc(OC)ccc1OC.Cl |
| InChI | InChI=1S/C13H20N2O4.ClH/c1-17-7-6-14-9-13(16)15-11-8-10(18-2)4-5-12(11)19-3;/h4-5,8,14H,6-7,9H2,1-3H3,(H,15,16);1H |
| InChIKey | WCEPDHQFKZNXMU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|