C13H19ClN2O4 — CID 79281493
N-(2-chloro-4,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide (PubChem CID 79281493) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide |
|---|---|
| PubChem CID | 79281493 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-(2-methoxyethylamino)acetamide |
| SMILES | COCCNCC(=O)Nc1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O4/c1-18-5-4-15-8-13(17)16-10-7-12(20-3)11(19-2)6-9(10)14/h6-7,15H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | WRQWVROTKPFEPA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|